C24H34FN5 — CID 170238749
[4-[3-(2,5-dimethylhex-2-en-3-ylamino)-5-fluoropiperidin-1-yl]-5-methylidene-6-[(Z)-prop-1-enyl]iminocyclohexa-1,3-dien-1-yl]cyanamide (PubChem CID 170238749) has the molecular formula C24H34FN5 and a molecular weight of 411.57 g/mol. Its IUPAC name is [4-[3-(2,5-dimethylhex-2-en-3-ylamino)-5-fluoropiperidin-1-yl]-5-methylidene-6-[(Z)-prop-1-enyl]iminocyclohexa-1,3-dien-1-yl]cyanamide.
| Compound Name | [4-[3-(2,5-dimethylhex-2-en-3-ylamino)-5-fluoropiperidin-1-yl]-5-methylidene-6-[(Z)-prop-1-enyl]iminocyclohexa-1,3-dien-1-yl]cyanamide |
|---|---|
| PubChem CID | 170238749 |
| Molecular Formula | C24H34FN5 |
| Molecular Weight | 411.57 g/mol |
| Exact Mass | 411.28 |
| IUPAC Name | [4-[3-(2,5-dimethylhex-2-en-3-ylamino)-5-fluoropiperidin-1-yl]-5-methylidene-6-[(Z)-prop-1-enyl]iminocyclohexa-1,3-dien-1-yl]cyanamide |
| SMILES | C=C1C(N2CC(F)CC(NC(CC(C)C)=C(C)C)C2)=CC=C(NC#N)/C1=N\C=C/C |
| InChI | InChI=1S/C24H34FN5/c1-7-10-27-24-18(6)23(9-8-21(24)28-15-26)30-13-19(25)12-20(14-30)29-22(17(4)5)11-16(2)3/h7-10,16,19-20,28-29H,6,11-14H2,1-5H3/b10-7-,27-24- |
| InChIKey | IGFOHXCJRMWDGX-XGBSHYDKSA-N |
| XLogP | 4.71 |
| TPSA | 63.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.57 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|