C21H37NO8S2 — CID 170239225
2-[3-[2-[3-(2-hydroxyethoxy)-2-methyl-3-oxopropyl]sulfanylethyl-(3-oxopropyl)amino]propanoyloxy]ethyl 2-methyl-3-methylsulfanylpropanoate (PubChem CID 170239225) has the molecular formula C21H37NO8S2 and a molecular weight of 495.66 g/mol. Its IUPAC name is 2-[3-[2-[3-(2-hydroxyethoxy)-2-methyl-3-oxopropyl]sulfanylethyl-(3-oxopropyl)amino]propanoyloxy]ethyl 2-methyl-3-methylsulfanylpropanoate.
| Compound Name | 2-[3-[2-[3-(2-hydroxyethoxy)-2-methyl-3-oxopropyl]sulfanylethyl-(3-oxopropyl)amino]propanoyloxy]ethyl 2-methyl-3-methylsulfanylpropanoate |
|---|---|
| PubChem CID | 170239225 |
| Molecular Formula | C21H37NO8S2 |
| Molecular Weight | 495.66 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | 2-[3-[2-[3-(2-hydroxyethoxy)-2-methyl-3-oxopropyl]sulfanylethyl-(3-oxopropyl)amino]propanoyloxy]ethyl 2-methyl-3-methylsulfanylpropanoate |
| SMILES | CSCC(C)C(=O)OCCOC(=O)CCN(CCC=O)CCSCC(C)C(=O)OCCO |
| InChI | InChI=1S/C21H37NO8S2/c1-17(15-31-3)20(26)30-13-12-28-19(25)5-7-22(6-4-9-23)8-14-32-16-18(2)21(27)29-11-10-24/h9,17-18,24H,4-8,10-16H2,1-3H3 |
| InChIKey | XMSSJVRKPNIPAL-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 119.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.66 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|