C11H17NO2 — CID 170241488
N-methyl-2,3,4,5,6a,10a-hexahydro-1,6-benzodioxocin-8-amine (PubChem CID 170241488) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is N-methyl-2,3,4,5,6a,10a-hexahydro-1,6-benzodioxocin-8-amine.
| Compound Name | N-methyl-2,3,4,5,6a,10a-hexahydro-1,6-benzodioxocin-8-amine |
|---|---|
| PubChem CID | 170241488 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | N-methyl-2,3,4,5,6a,10a-hexahydro-1,6-benzodioxocin-8-amine |
| SMILES | CNC1=CC2OCCCCOC2C=C1 |
| InChI | InChI=1S/C11H17NO2/c1-12-9-4-5-10-11(8-9)14-7-3-2-6-13-10/h4-5,8,10-12H,2-3,6-7H2,1H3 |
| InChIKey | OLQWRQDVVJRJRL-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |