C23H28O5S — CID 170242357
(2S,3R,4R,5S,6R)-2-[3-(3,4-dihydro-2H-chromen-6-ylmethyl)-4-methylphenyl]-6-methylsulfanyloxane-3,4,5-triol (PubChem CID 170242357) has the molecular formula C23H28O5S and a molecular weight of 416.54 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[3-(3,4-dihydro-2H-chromen-6-ylmethyl)-4-methylphenyl]-6-methylsulfanyloxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[3-(3,4-dihydro-2H-chromen-6-ylmethyl)-4-methylphenyl]-6-methylsulfanyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 170242357 |
| Molecular Formula | C23H28O5S |
| Molecular Weight | 416.54 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[3-(3,4-dihydro-2H-chromen-6-ylmethyl)-4-methylphenyl]-6-methylsulfanyloxane-3,4,5-triol |
| SMILES | CS[C@H]1O[C@@H](c2ccc(C)c(Cc3ccc4c(c3)CCCO4)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H28O5S/c1-13-5-7-16(22-20(25)19(24)21(26)23(28-22)29-2)12-17(13)11-14-6-8-18-15(10-14)4-3-9-27-18/h5-8,10,12,19-26H,3-4,9,11H2,1-2H3/t19-,20-,21+,22+,23-/m1/s1 |
| InChIKey | KSKPSZLCVBBOHK-MHMIHQHRSA-N |
| XLogP | 2.75 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.54 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |