C18H33FN2 — CID 170242542
(3R,6R)-5-N-[(1Z)-buta-1,3-dienyl]-4-(1-fluoropent-2-en-2-yl)-6-methyloctane-3,5-diamine (PubChem CID 170242542) has the molecular formula C18H33FN2 and a molecular weight of 296.47 g/mol. Its IUPAC name is (3R,6R)-5-N-[(1Z)-buta-1,3-dienyl]-4-(1-fluoropent-2-en-2-yl)-6-methyloctane-3,5-diamine.
| Compound Name | (3R,6R)-5-N-[(1Z)-buta-1,3-dienyl]-4-(1-fluoropent-2-en-2-yl)-6-methyloctane-3,5-diamine |
|---|---|
| PubChem CID | 170242542 |
| Molecular Formula | C18H33FN2 |
| Molecular Weight | 296.47 g/mol |
| Exact Mass | 296.26 |
| IUPAC Name | (3R,6R)-5-N-[(1Z)-buta-1,3-dienyl]-4-(1-fluoropent-2-en-2-yl)-6-methyloctane-3,5-diamine |
| SMILES | C=C/C=C\NC(C(C(=CCC)CF)[C@H](N)CC)[C@H](C)CC |
| InChI | InChI=1S/C18H33FN2/c1-6-10-12-21-18(14(5)8-3)17(16(20)9-4)15(13-19)11-7-2/h6,10-12,14,16-18,21H,1,7-9,13,20H2,2-5H3/b12-10-,15-11?/t14-,16-,17?,18?/m1/s1 |
| InChIKey | XNLJCYNFHIYAGG-CIKRGAAWSA-N |
| XLogP | 4.35 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.47 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|