C14H20N6OS — CID 17024275
2-[[4-ethyl-5-[(3-methylpyrazol-1-yl)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-prop-2-enylacetamide (PubChem CID 17024275) has the molecular formula C14H20N6OS and a molecular weight of 320.42 g/mol. Its IUPAC name is 2-[[4-ethyl-5-[(3-methylpyrazol-1-yl)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-prop-2-enylacetamide.
| Compound Name | 2-[[4-ethyl-5-[(3-methylpyrazol-1-yl)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 17024275 |
| Molecular Formula | C14H20N6OS |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 2-[[4-ethyl-5-[(3-methylpyrazol-1-yl)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)CSc1nnc(Cn2ccc(C)n2)n1CC |
| InChI | InChI=1S/C14H20N6OS/c1-4-7-15-13(21)10-22-14-17-16-12(20(14)5-2)9-19-8-6-11(3)18-19/h4,6,8H,1,5,7,9-10H2,2-3H3,(H,15,21) |
| InChIKey | YBBPFYSTUXBPQC-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|