C35H15N5O5 — CID 170243131
3-[[6,13-bis(4-cyanophenyl)-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8(16),9,11(15)-pentaen-2-yl]oxy]benzonitrile (PubChem CID 170243131) has the molecular formula C35H15N5O5 and a molecular weight of 585.54 g/mol. Its IUPAC name is 3-[[6,13-bis(4-cyanophenyl)-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8(16),9,11(15)-pentaen-2-yl]oxy]benzonitrile.
| Compound Name | 3-[[6,13-bis(4-cyanophenyl)-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8(16),9,11(15)-pentaen-2-yl]oxy]benzonitrile |
|---|---|
| PubChem CID | 170243131 |
| Molecular Formula | C35H15N5O5 |
| Molecular Weight | 585.54 g/mol |
| Exact Mass | 585.11 |
| IUPAC Name | 3-[[6,13-bis(4-cyanophenyl)-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8(16),9,11(15)-pentaen-2-yl]oxy]benzonitrile |
| SMILES | N#Cc1ccc(N2C(=O)c3ccc4c5c(c(Oc6cccc(C#N)c6)cc(c35)C2=O)C(=O)N(c2ccc(C#N)cc2)C4=O)cc1 |
| InChI | InChI=1S/C35H15N5O5/c36-16-19-4-8-22(9-5-19)39-32(41)25-12-13-26-30-29(25)27(34(39)43)15-28(45-24-3-1-2-21(14-24)18-38)31(30)35(44)40(33(26)42)23-10-6-20(17-37)7-11-23/h1-15H |
| InChIKey | LXJYJVHLIDCZTD-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 155.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.54 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|