C22H34N4O — CID 170243851
N-[[7-ethyl-5-[[(3Z,5Z)-5-propan-2-ylhepta-1,3,5-trien-2-yl]amino]-2H-1,4-diazepin-6-yl]methyl]-N-propan-2-ylformamide (PubChem CID 170243851) has the molecular formula C22H34N4O and a molecular weight of 370.54 g/mol. Its IUPAC name is N-[[7-ethyl-5-[[(3Z,5Z)-5-propan-2-ylhepta-1,3,5-trien-2-yl]amino]-2H-1,4-diazepin-6-yl]methyl]-N-propan-2-ylformamide.
| Compound Name | N-[[7-ethyl-5-[[(3Z,5Z)-5-propan-2-ylhepta-1,3,5-trien-2-yl]amino]-2H-1,4-diazepin-6-yl]methyl]-N-propan-2-ylformamide |
|---|---|
| PubChem CID | 170243851 |
| Molecular Formula | C22H34N4O |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.27 |
| IUPAC Name | N-[[7-ethyl-5-[[(3Z,5Z)-5-propan-2-ylhepta-1,3,5-trien-2-yl]amino]-2H-1,4-diazepin-6-yl]methyl]-N-propan-2-ylformamide |
| SMILES | C=C(/C=C\C(=C/C)C(C)C)NC1=C(CN(C=O)C(C)C)C(CC)=NCC=N1 |
| InChI | InChI=1S/C22H34N4O/c1-8-19(16(3)4)11-10-18(7)25-22-20(14-26(15-27)17(5)6)21(9-2)23-12-13-24-22/h8,10-11,13,15-17,25H,7,9,12,14H2,1-6H3/b11-10-,19-8+ |
| InChIKey | GUTRDFVHBBAPDS-PXNCOTNSSA-N |
| XLogP | 4.26 |
| TPSA | 57.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|