C44H37N3O — CID 170244145
(3E,5E)-4-(6b,7-dihydrofluoranthen-3-yl)-N'-(N-benzyl-C-phenylcarbonimidoyl)-2-methylidene-8,9-dihydro-7H-1-benzoxonine-6-carboximidamide (PubChem CID 170244145) has the molecular formula C44H37N3O and a molecular weight of 623.80 g/mol. Its IUPAC name is (3E,5E)-4-(6b,7-dihydrofluoranthen-3-yl)-N'-(N-benzyl-C-phenylcarbonimidoyl)-2-methylidene-8,9-dihydro-7H-1-benzoxonine-6-carboximidamide.
| Compound Name | (3E,5E)-4-(6b,7-dihydrofluoranthen-3-yl)-N'-(N-benzyl-C-phenylcarbonimidoyl)-2-methylidene-8,9-dihydro-7H-1-benzoxonine-6-carboximidamide |
|---|---|
| PubChem CID | 170244145 |
| Molecular Formula | C44H37N3O |
| Molecular Weight | 623.80 g/mol |
| Exact Mass | 623.29 |
| IUPAC Name | (3E,5E)-4-(6b,7-dihydrofluoranthen-3-yl)-N'-(N-benzyl-C-phenylcarbonimidoyl)-2-methylidene-8,9-dihydro-7H-1-benzoxonine-6-carboximidamide |
| SMILES | C=C1/C=C(c2ccc3c4c(cccc24)C2CC=CC=C32)\C=C(C(\N)=N\C(=N\Cc2ccccc2)c2ccccc2)/CC2=C(C=CCC2)O1 |
| InChI | InChI=1S/C44H37N3O/c1-29-25-33(35-23-24-40-37-19-10-9-18-36(37)39-21-12-20-38(35)42(39)40)27-34(26-32-17-8-11-22-41(32)48-29)43(45)47-44(31-15-6-3-7-16-31)46-28-30-13-4-2-5-14-30/h2-7,9-16,19-25,27,36H,1,8,17-18,26,28H2,(H2,45,46,47)/b33-25+,34-27+ |
| InChIKey | KTBSIAZJIQITLM-MVMPATBUSA-N |
| XLogP | 10.13 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.80 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|