C17H19N3O5 — CID 170244818
2-(2,6-dioxopiperidin-3-yl)-4-(2-ethoxyethylamino)isoindole-1,3-dione (PubChem CID 170244818) has the molecular formula C17H19N3O5 and a molecular weight of 345.36 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-(2-ethoxyethylamino)isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-(2-ethoxyethylamino)isoindole-1,3-dione |
|---|---|
| PubChem CID | 170244818 |
| Molecular Formula | C17H19N3O5 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-(2-ethoxyethylamino)isoindole-1,3-dione |
| SMILES | CCOCCNc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C17H19N3O5/c1-2-25-9-8-18-11-5-3-4-10-14(11)17(24)20(16(10)23)12-6-7-13(21)19-15(12)22/h3-5,12,18H,2,6-9H2,1H3,(H,19,21,22) |
| InChIKey | ZTSFDPVRTAFLPT-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|