About 4-(4,4-dimethylcyclohexyl)-2-iodo-1-methylnaphthalene
4-(4,4-dimethylcyclohexyl)-2-iodo-1-methylnaphthalene (PubChem CID 170245098) has the molecular formula C19H23I
and a molecular weight of 378.30 g/mol. Its IUPAC name is 4-(4,4-dimethylcyclohexyl)-2-iodo-1-methylnaphthalene.
Molecular Properties
| Compound Name | 4-(4,4-dimethylcyclohexyl)-2-iodo-1-methylnaphthalene |
| PubChem CID | 170245098 |
| Molecular Formula | C19H23I |
| Molecular Weight | 378.30 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 4-(4,4-dimethylcyclohexyl)-2-iodo-1-methylnaphthalene |
| SMILES | Cc1c(I)cc(C2CCC(C)(C)CC2)c2ccccc12 |
| InChI | InChI=1S/C19H23I/c1-13-15-6-4-5-7-16(15)17(12-18(13)20)14-8-10-19(2,3)11-9-14/h4-7,12,14H,8-11H2,1-3H3 |
| InChIKey | JRDYHROSBNOOGL-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.30 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-(4,4-dimethylcyclohexyl)-2-iodo-1-methylnaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,4-dimethylcyclohexyl)-2-iodo-1-methylnaphthalene?
The IUPAC name of 4-(4,4-dimethylcyclohexyl)-2-iodo-1-methylnaphthalene (CID 170245098) is 4-(4,4-dimethylcyclohexyl)-2-iodo-1-methylnaphthalene.
What is the SMILES notation for 4-(4,4-dimethylcyclohexyl)-2-iodo-1-methylnaphthalene?
The canonical SMILES for 4-(4,4-dimethylcyclohexyl)-2-iodo-1-methylnaphthalene is Cc1c(I)cc(C2CCC(C)(C)CC2)c2ccccc12.
What is the InChIKey of 4-(4,4-dimethylcyclohexyl)-2-iodo-1-methylnaphthalene?
The InChIKey is JRDYHROSBNOOGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23I/c1-13-15-6-4-5-7-16(15)17(12-18(13)20)14-8-10-19(2,3)11-9-14/h4-7,12,14H,8-11H2,1-3H3.
What are the key properties of 4-(4,4-dimethylcyclohexyl)-2-iodo-1-methylnaphthalene?
4-(4,4-dimethylcyclohexyl)-2-iodo-1-methylnaphthalene has a molecular weight of 378.30 g/mol, XLogP of 6.44, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,4-dimethylcyclohexyl)-2-iodo-1-methylnaphthalene is sourced from PubChem (CID 170245098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).