C20H11N4OS2+ — CID 170245176
2-[2-(1,2-benzothiazol-6-yl)-[1,3]thiazolo[5,4-c]pyridin-6-yl]-1,2-benzoxazol-2-ium (PubChem CID 170245176) has the molecular formula C20H11N4OS2+ and a molecular weight of 387.47 g/mol. Its IUPAC name is 2-[2-(1,2-benzothiazol-6-yl)-[1,3]thiazolo[5,4-c]pyridin-6-yl]-1,2-benzoxazol-2-ium.
| Compound Name | 2-[2-(1,2-benzothiazol-6-yl)-[1,3]thiazolo[5,4-c]pyridin-6-yl]-1,2-benzoxazol-2-ium |
|---|---|
| PubChem CID | 170245176 |
| Molecular Formula | C20H11N4OS2+ |
| Molecular Weight | 387.47 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | 2-[2-(1,2-benzothiazol-6-yl)-[1,3]thiazolo[5,4-c]pyridin-6-yl]-1,2-benzoxazol-2-ium |
| SMILES | c1ccc2o[n+](-c3cc4nc(-c5ccc6cnsc6c5)sc4cn3)cc2c1 |
| InChI | InChI=1S/C20H11N4OS2/c1-2-4-16-14(3-1)11-24(25-16)19-8-15-18(10-21-19)26-20(23-15)12-5-6-13-9-22-27-17(13)7-12/h1-11H/q+1 |
| InChIKey | ZVEYYYUSHPKYPX-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 55.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.47 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|