C93H76N2 — CID 170245382
1-N,3-N-bis(4-tert-butyl-2,6-diphenylphenyl)-5-(9-phenylfluoren-9-yl)-1-N,3-N-bis(4-phenylphenyl)benzene-1,3-diamine (PubChem CID 170245382) has the molecular formula C93H76N2 and a molecular weight of 1221.65 g/mol. Its IUPAC name is 1-N,3-N-bis(4-tert-butyl-2,6-diphenylphenyl)-5-(9-phenylfluoren-9-yl)-1-N,3-N-bis(4-phenylphenyl)benzene-1,3-diamine.
| Compound Name | 1-N,3-N-bis(4-tert-butyl-2,6-diphenylphenyl)-5-(9-phenylfluoren-9-yl)-1-N,3-N-bis(4-phenylphenyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 170245382 |
| Molecular Formula | C93H76N2 |
| Molecular Weight | 1221.65 g/mol |
| Exact Mass | 1220.60 |
| IUPAC Name | 1-N,3-N-bis(4-tert-butyl-2,6-diphenylphenyl)-5-(9-phenylfluoren-9-yl)-1-N,3-N-bis(4-phenylphenyl)benzene-1,3-diamine |
| SMILES | CC(C)(C)c1cc(-c2ccccc2)c(N(c2ccc(-c3ccccc3)cc2)c2cc(N(c3ccc(-c4ccccc4)cc3)c3c(-c4ccccc4)cc(C(C)(C)C)cc3-c3ccccc3)cc(C3(c4ccccc4)c4ccccc4-c4ccccc43)c2)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C93H76N2/c1-91(2,3)74-60-83(69-36-18-9-19-37-69)89(84(61-74)70-38-20-10-21-39-70)94(77-54-50-67(51-55-77)65-32-14-7-15-33-65)79-58-76(93(73-44-26-13-27-45-73)87-48-30-28-46-81(87)82-47-29-31-49-88(82)93)59-80(64-79)95(78-56-52-68(53-57-78)66-34-16-8-17-35-66)90-85(71-40-22-11-23-41-71)62-75(92(4,5)6)63-86(90)72-42-24-12-25-43-72/h7-64H,1-6H3 |
| InChIKey | YDJJTKOXMBUVQK-UHFFFAOYSA-N |
| XLogP | 25.59 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 95 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1221.65 |
| LogP ≤ 5 | 25.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |