C13H19NS — CID 170245479
N-(5,5,8-trimethyl-7,8-dihydro-6H-naphthalen-2-yl)thiohydroxylamine (PubChem CID 170245479) has the molecular formula C13H19NS and a molecular weight of 221.37 g/mol. Its IUPAC name is N-(5,5,8-trimethyl-7,8-dihydro-6H-naphthalen-2-yl)thiohydroxylamine.
| Compound Name | N-(5,5,8-trimethyl-7,8-dihydro-6H-naphthalen-2-yl)thiohydroxylamine |
|---|---|
| PubChem CID | 170245479 |
| Molecular Formula | C13H19NS |
| Molecular Weight | 221.37 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | N-(5,5,8-trimethyl-7,8-dihydro-6H-naphthalen-2-yl)thiohydroxylamine |
| SMILES | CC1CCC(C)(C)c2ccc(NS)cc21 |
| InChI | InChI=1S/C13H19NS/c1-9-6-7-13(2,3)12-5-4-10(14-15)8-11(9)12/h4-5,8-9,14-15H,6-7H2,1-3H3 |
| InChIKey | SLSOBZNPRVMEIL-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.37 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|