About 5-(5-methoxy-3,5-dimethylhexoxy)-3-methyl-N-(4-methylpentan-2-yl)hexan-1-amine
5-(5-methoxy-3,5-dimethylhexoxy)-3-methyl-N-(4-methylpentan-2-yl)hexan-1-amine (PubChem CID 170245649) has the molecular formula C22H47NO2
and a molecular weight of 357.62 g/mol. Its IUPAC name is 5-(5-methoxy-3,5-dimethylhexoxy)-3-methyl-N-(4-methylpentan-2-yl)hexan-1-amine.
Molecular Properties
| Compound Name | 5-(5-methoxy-3,5-dimethylhexoxy)-3-methyl-N-(4-methylpentan-2-yl)hexan-1-amine |
| PubChem CID | 170245649 |
| Molecular Formula | C22H47NO2 |
| Molecular Weight | 357.62 g/mol |
| Exact Mass | 357.36 |
| IUPAC Name | 5-(5-methoxy-3,5-dimethylhexoxy)-3-methyl-N-(4-methylpentan-2-yl)hexan-1-amine |
| SMILES | COC(C)(C)CC(C)CCOC(C)CC(C)CCNC(C)CC(C)C |
| InChI | InChI=1S/C22H47NO2/c1-17(2)14-20(5)23-12-10-18(3)15-21(6)25-13-11-19(4)16-22(7,8)24-9/h17-21,23H,10-16H2,1-9H3 |
| InChIKey | PATYZQUWVICYBZ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 357.62 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(5-methoxy-3,5-dimethylhexoxy)-3-methyl-N-(4-methylpentan-2-yl)hexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5-methoxy-3,5-dimethylhexoxy)-3-methyl-N-(4-methylpentan-2-yl)hexan-1-amine?
The IUPAC name of 5-(5-methoxy-3,5-dimethylhexoxy)-3-methyl-N-(4-methylpentan-2-yl)hexan-1-amine (CID 170245649) is 5-(5-methoxy-3,5-dimethylhexoxy)-3-methyl-N-(4-methylpentan-2-yl)hexan-1-amine.
What is the SMILES notation for 5-(5-methoxy-3,5-dimethylhexoxy)-3-methyl-N-(4-methylpentan-2-yl)hexan-1-amine?
The canonical SMILES for 5-(5-methoxy-3,5-dimethylhexoxy)-3-methyl-N-(4-methylpentan-2-yl)hexan-1-amine is COC(C)(C)CC(C)CCOC(C)CC(C)CCNC(C)CC(C)C.
What is the InChIKey of 5-(5-methoxy-3,5-dimethylhexoxy)-3-methyl-N-(4-methylpentan-2-yl)hexan-1-amine?
The InChIKey is PATYZQUWVICYBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H47NO2/c1-17(2)14-20(5)23-12-10-18(3)15-21(6)25-13-11-19(4)16-22(7,8)24-9/h17-21,23H,10-16H2,1-9H3.
What are the key properties of 5-(5-methoxy-3,5-dimethylhexoxy)-3-methyl-N-(4-methylpentan-2-yl)hexan-1-amine?
5-(5-methoxy-3,5-dimethylhexoxy)-3-methyl-N-(4-methylpentan-2-yl)hexan-1-amine has a molecular weight of 357.62 g/mol, XLogP of 5.67, 15 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-methoxy-3,5-dimethylhexoxy)-3-methyl-N-(4-methylpentan-2-yl)hexan-1-amine is sourced from PubChem (CID 170245649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).