C26H33ClN4O5 — CID 170245684
2-[5-chloro-8-[(2Z,4Z)-2,5-diaminopenta-2,4-dienoxy]-1-(2-oxopyrrolidin-1-yl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]cyclohexane-1-carboxylic acid (PubChem CID 170245684) has the molecular formula C26H33ClN4O5 and a molecular weight of 517.03 g/mol. Its IUPAC name is 2-[5-chloro-8-[(2Z,4Z)-2,5-diaminopenta-2,4-dienoxy]-1-(2-oxopyrrolidin-1-yl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]cyclohexane-1-carboxylic acid.
| Compound Name | 2-[5-chloro-8-[(2Z,4Z)-2,5-diaminopenta-2,4-dienoxy]-1-(2-oxopyrrolidin-1-yl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 170245684 |
| Molecular Formula | C26H33ClN4O5 |
| Molecular Weight | 517.03 g/mol |
| Exact Mass | 516.21 |
| IUPAC Name | 2-[5-chloro-8-[(2Z,4Z)-2,5-diaminopenta-2,4-dienoxy]-1-(2-oxopyrrolidin-1-yl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]cyclohexane-1-carboxylic acid |
| SMILES | N/C=C\C=C(/N)COc1ccc(Cl)c2c1C(N1CCCC1=O)N(C(=O)C1CCCCC1C(=O)O)CC2 |
| InChI | InChI=1S/C26H33ClN4O5/c27-20-9-10-21(36-15-16(29)5-3-12-28)23-19(20)11-14-31(24(23)30-13-4-8-22(30)32)25(33)17-6-1-2-7-18(17)26(34)35/h3,5,9-10,12,17-18,24H,1-2,4,6-8,11,13-15,28-29H2,(H,34,35)/b12-3-,16-5- |
| InChIKey | PFZJBNQOJDIKTH-BQIHHPISSA-N |
| XLogP | 2.93 |
| TPSA | 139.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.03 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|