C15H22N2 — CID 170246048
(2E)-N-ethenyl-1-methyl-6-methylidene-2-(4-methylpent-1-en-3-ylidene)piperidin-3-imine (PubChem CID 170246048) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is (2E)-N-ethenyl-1-methyl-6-methylidene-2-(4-methylpent-1-en-3-ylidene)piperidin-3-imine.
| Compound Name | (2E)-N-ethenyl-1-methyl-6-methylidene-2-(4-methylpent-1-en-3-ylidene)piperidin-3-imine |
|---|---|
| PubChem CID | 170246048 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | (2E)-N-ethenyl-1-methyl-6-methylidene-2-(4-methylpent-1-en-3-ylidene)piperidin-3-imine |
| SMILES | C=C/N=C1\CCC(=C)N(C)\C1=C(\C=C)C(C)C |
| InChI | InChI=1S/C15H22N2/c1-7-13(11(3)4)15-14(16-8-2)10-9-12(5)17(15)6/h7-8,11H,1-2,5,9-10H2,3-4,6H3/b15-13-,16-14+ |
| InChIKey | QNFRFLLPOHHUCQ-VCFJNTAESA-N |
| XLogP | 3.91 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|