C21H37N3 — CID 170246685
8-[4-[(5Z)-hepta-1,5-dien-4-yl]piperazin-1-yl]-N,2-dimethyloct-2-en-4-imine (PubChem CID 170246685) has the molecular formula C21H37N3 and a molecular weight of 331.55 g/mol. Its IUPAC name is 8-[4-[(5Z)-hepta-1,5-dien-4-yl]piperazin-1-yl]-N,2-dimethyloct-2-en-4-imine.
| Compound Name | 8-[4-[(5Z)-hepta-1,5-dien-4-yl]piperazin-1-yl]-N,2-dimethyloct-2-en-4-imine |
|---|---|
| PubChem CID | 170246685 |
| Molecular Formula | C21H37N3 |
| Molecular Weight | 331.55 g/mol |
| Exact Mass | 331.30 |
| IUPAC Name | 8-[4-[(5Z)-hepta-1,5-dien-4-yl]piperazin-1-yl]-N,2-dimethyloct-2-en-4-imine |
| SMILES | C=CCC(/C=C\C)N1CCN(CCCC/C(C=C(C)C)=N/C)CC1 |
| InChI | InChI=1S/C21H37N3/c1-6-10-21(11-7-2)24-16-14-23(15-17-24)13-9-8-12-20(22-5)18-19(3)4/h6-7,11,18,21H,1,8-10,12-17H2,2-5H3/b11-7-,22-20- |
| InChIKey | XZIPJLYRILZYGW-QKHOCTPZSA-N |
| XLogP | 4.33 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.55 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|