C9H9F3N2O2 — CID 17024714
1-(1-ethylpyrazol-4-yl)-4,4,4-trifluorobutane-1,3-dione (PubChem CID 17024714) has the molecular formula C9H9F3N2O2 and a molecular weight of 234.18 g/mol. Its IUPAC name is 1-(1-ethylpyrazol-4-yl)-4,4,4-trifluorobutane-1,3-dione.
| Compound Name | 1-(1-ethylpyrazol-4-yl)-4,4,4-trifluorobutane-1,3-dione |
|---|---|
| PubChem CID | 17024714 |
| Molecular Formula | C9H9F3N2O2 |
| Molecular Weight | 234.18 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | 1-(1-ethylpyrazol-4-yl)-4,4,4-trifluorobutane-1,3-dione |
| SMILES | CCn1cc(C(=O)CC(=O)C(F)(F)F)cn1 |
| InChI | InChI=1S/C9H9F3N2O2/c1-2-14-5-6(4-13-14)7(15)3-8(16)9(10,11)12/h4-5H,2-3H2,1H3 |
| InChIKey | NQTDLJFJINBGQG-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.18 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|