C24H21N5OS — CID 170247166
2-[(9R)-7-(2-amino-1,3-benzothiazol-6-yl)-9-methyl-3,6,7,8-tetrahydropyrazolo[4,5-f]quinolin-9-yl]phenol (PubChem CID 170247166) has the molecular formula C24H21N5OS and a molecular weight of 427.53 g/mol. Its IUPAC name is 2-[(9R)-7-(2-amino-1,3-benzothiazol-6-yl)-9-methyl-3,6,7,8-tetrahydropyrazolo[4,5-f]quinolin-9-yl]phenol.
| Compound Name | 2-[(9R)-7-(2-amino-1,3-benzothiazol-6-yl)-9-methyl-3,6,7,8-tetrahydropyrazolo[4,5-f]quinolin-9-yl]phenol |
|---|---|
| PubChem CID | 170247166 |
| Molecular Formula | C24H21N5OS |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 2-[(9R)-7-(2-amino-1,3-benzothiazol-6-yl)-9-methyl-3,6,7,8-tetrahydropyrazolo[4,5-f]quinolin-9-yl]phenol |
| SMILES | C[C@@]1(c2ccccc2O)CC(c2ccc3nc(N)sc3c2)Nc2ccc3[nH]ncc3c21 |
| InChI | InChI=1S/C24H21N5OS/c1-24(15-4-2-3-5-20(15)30)11-19(13-6-7-17-21(10-13)31-23(25)28-17)27-18-9-8-16-14(22(18)24)12-26-29-16/h2-10,12,19,27,30H,11H2,1H3,(H2,25,28)(H,26,29)/t19?,24-/m0/s1 |
| InChIKey | NGZDVEXJTJVWDM-WIIYFNMSSA-N |
| XLogP | 5.32 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |