About 5-iodo-N,N,6-trimethylpyridin-2-amine
5-iodo-N,N,6-trimethylpyridin-2-amine (PubChem CID 170247686) has the molecular formula C8H11IN2
and a molecular weight of 262.09 g/mol. Its IUPAC name is 5-iodo-N,N,6-trimethylpyridin-2-amine.
Molecular Properties
| Compound Name | 5-iodo-N,N,6-trimethylpyridin-2-amine |
| PubChem CID | 170247686 |
| Molecular Formula | C8H11IN2 |
| Molecular Weight | 262.09 g/mol |
| Exact Mass | 262.00 |
| IUPAC Name | 5-iodo-N,N,6-trimethylpyridin-2-amine |
| SMILES | Cc1nc(N(C)C)ccc1I |
| InChI | InChI=1S/C8H11IN2/c1-6-7(9)4-5-8(10-6)11(2)3/h4-5H,1-3H3 |
| InChIKey | XCPQOTRGXMSQSZ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.09 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-iodo-N,N,6-trimethylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodo-N,N,6-trimethylpyridin-2-amine?
The IUPAC name of 5-iodo-N,N,6-trimethylpyridin-2-amine (CID 170247686) is 5-iodo-N,N,6-trimethylpyridin-2-amine.
What is the SMILES notation for 5-iodo-N,N,6-trimethylpyridin-2-amine?
The canonical SMILES for 5-iodo-N,N,6-trimethylpyridin-2-amine is Cc1nc(N(C)C)ccc1I.
What is the InChIKey of 5-iodo-N,N,6-trimethylpyridin-2-amine?
The InChIKey is XCPQOTRGXMSQSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11IN2/c1-6-7(9)4-5-8(10-6)11(2)3/h4-5H,1-3H3.
What are the key properties of 5-iodo-N,N,6-trimethylpyridin-2-amine?
5-iodo-N,N,6-trimethylpyridin-2-amine has a molecular weight of 262.09 g/mol, XLogP of 2.06, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodo-N,N,6-trimethylpyridin-2-amine is sourced from PubChem (CID 170247686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).