C11H12F3P — CID 170248102
(1,6,7-trifluoro-2,5-dimethyl-2,3-dihydroinden-1-yl)phosphane (PubChem CID 170248102) has the molecular formula C11H12F3P and a molecular weight of 232.18 g/mol. Its IUPAC name is (1,6,7-trifluoro-2,5-dimethyl-2,3-dihydroinden-1-yl)phosphane.
| Compound Name | (1,6,7-trifluoro-2,5-dimethyl-2,3-dihydroinden-1-yl)phosphane |
|---|---|
| PubChem CID | 170248102 |
| Molecular Formula | C11H12F3P |
| Molecular Weight | 232.18 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | (1,6,7-trifluoro-2,5-dimethyl-2,3-dihydroinden-1-yl)phosphane |
| SMILES | Cc1cc2c(c(F)c1F)C(F)(P)C(C)C2 |
| InChI | InChI=1S/C11H12F3P/c1-5-3-7-4-6(2)11(14,15)8(7)10(13)9(5)12/h3,6H,4,15H2,1-2H3 |
| InChIKey | NKVUZUYKLHJLAQ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.18 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|