About 7-(3-nitrophenyl)pyrazolo[1,5-a]pyrimidine
7-(3-nitrophenyl)pyrazolo[1,5-a]pyrimidine (PubChem CID 17024817) has the molecular formula C12H8N4O2
and a molecular weight of 240.22 g/mol. Its IUPAC name is 7-(3-nitrophenyl)pyrazolo[1,5-a]pyrimidine.
Molecular Properties
| Compound Name | 7-(3-nitrophenyl)pyrazolo[1,5-a]pyrimidine |
| PubChem CID | 17024817 |
| Molecular Formula | C12H8N4O2 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 7-(3-nitrophenyl)pyrazolo[1,5-a]pyrimidine |
| SMILES | O=[N+]([O-])c1cccc(-c2ccnc3ccnn23)c1 |
| InChI | InChI=1S/C12H8N4O2/c17-16(18)10-3-1-2-9(8-10)11-4-6-13-12-5-7-14-15(11)12/h1-8H |
| InChIKey | OBBNCPWRLTWSHC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-(3-nitrophenyl)pyrazolo[1,5-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(3-nitrophenyl)pyrazolo[1,5-a]pyrimidine?
The IUPAC name of 7-(3-nitrophenyl)pyrazolo[1,5-a]pyrimidine (CID 17024817) is 7-(3-nitrophenyl)pyrazolo[1,5-a]pyrimidine.
What is the SMILES notation for 7-(3-nitrophenyl)pyrazolo[1,5-a]pyrimidine?
The canonical SMILES for 7-(3-nitrophenyl)pyrazolo[1,5-a]pyrimidine is O=[N+]([O-])c1cccc(-c2ccnc3ccnn23)c1.
What is the InChIKey of 7-(3-nitrophenyl)pyrazolo[1,5-a]pyrimidine?
The InChIKey is OBBNCPWRLTWSHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N4O2/c17-16(18)10-3-1-2-9(8-10)11-4-6-13-12-5-7-14-15(11)12/h1-8H.
What are the key properties of 7-(3-nitrophenyl)pyrazolo[1,5-a]pyrimidine?
7-(3-nitrophenyl)pyrazolo[1,5-a]pyrimidine has a molecular weight of 240.22 g/mol, XLogP of 2.30, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(3-nitrophenyl)pyrazolo[1,5-a]pyrimidine is sourced from PubChem (CID 17024817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).