C28H36N3OS+ — CID 170248405
dimethyl-[3-[(4Z)-4-[(Z)-3-(3-methyl-2H-1,3-benzoxazol-2-yl)prop-2-enylidene]quinolin-1-yl]propyl]-(2-sulfanylpropan-2-yl)azanium (PubChem CID 170248405) has the molecular formula C28H36N3OS+ and a molecular weight of 462.68 g/mol. Its IUPAC name is dimethyl-[3-[(4Z)-4-[(Z)-3-(3-methyl-2H-1,3-benzoxazol-2-yl)prop-2-enylidene]quinolin-1-yl]propyl]-(2-sulfanylpropan-2-yl)azanium.
| Compound Name | dimethyl-[3-[(4Z)-4-[(Z)-3-(3-methyl-2H-1,3-benzoxazol-2-yl)prop-2-enylidene]quinolin-1-yl]propyl]-(2-sulfanylpropan-2-yl)azanium |
|---|---|
| PubChem CID | 170248405 |
| Molecular Formula | C28H36N3OS+ |
| Molecular Weight | 462.68 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | dimethyl-[3-[(4Z)-4-[(Z)-3-(3-methyl-2H-1,3-benzoxazol-2-yl)prop-2-enylidene]quinolin-1-yl]propyl]-(2-sulfanylpropan-2-yl)azanium |
| SMILES | CN1c2ccccc2OC1/C=C\C=C1\C=CN(CCC[N+](C)(C)C(C)(C)S)c2ccccc21 |
| InChI | InChI=1S/C28H35N3OS/c1-28(2,33)31(4,5)21-11-19-30-20-18-22(23-13-6-7-14-24(23)30)12-10-17-27-29(3)25-15-8-9-16-26(25)32-27/h6-10,12-18,20,27H,11,19,21H2,1-5H3/p+1/b17-10-,22-12- |
| InChIKey | WNVZBMDPGBWDMR-SIIXZMNFSA-O |
| XLogP | 5.95 |
| TPSA | 15.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.68 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|