C16H21N3 — CID 170249062
N-(C-cyclohexa-1,3-dien-1-yl-N-methylcarbonimidoyl)-N'-methylcyclohexa-1,5-diene-1-carboximidamide (PubChem CID 170249062) has the molecular formula C16H21N3 and a molecular weight of 255.37 g/mol. Its IUPAC name is N-(C-cyclohexa-1,3-dien-1-yl-N-methylcarbonimidoyl)-N'-methylcyclohexa-1,5-diene-1-carboximidamide.
| Compound Name | N-(C-cyclohexa-1,3-dien-1-yl-N-methylcarbonimidoyl)-N'-methylcyclohexa-1,5-diene-1-carboximidamide |
|---|---|
| PubChem CID | 170249062 |
| Molecular Formula | C16H21N3 |
| Molecular Weight | 255.37 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | N-(C-cyclohexa-1,3-dien-1-yl-N-methylcarbonimidoyl)-N'-methylcyclohexa-1,5-diene-1-carboximidamide |
| SMILES | C/N=C(/N/C(=N/C)C1=CC=CCC1)C1=CCCC=C1 |
| InChI | InChI=1S/C16H21N3/c1-17-15(13-9-5-3-6-10-13)19-16(18-2)14-11-7-4-8-12-14/h3,5,7,9,11-12H,4,6,8,10H2,1-2H3,(H,17,18,19) |
| InChIKey | QBKFGYMOHQVDQV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|