C30H45FO4S — CID 170249204
(1S,2S,5R,6S,9S,10R,13R)-5-[(2S,5R)-3-(benzenesulfonyl)-5-hydroxyhexan-2-yl]-13-fluoro-6,10,14-trimethyltetracyclo[7.6.0.02,6.010,14]pentadecan-13-ol (PubChem CID 170249204) has the molecular formula C30H45FO4S and a molecular weight of 520.75 g/mol. Its IUPAC name is (1S,2S,5R,6S,9S,10R,13R)-5-[(2S,5R)-3-(benzenesulfonyl)-5-hydroxyhexan-2-yl]-13-fluoro-6,10,14-trimethyltetracyclo[7.6.0.02,6.010,14]pentadecan-13-ol.
| Compound Name | (1S,2S,5R,6S,9S,10R,13R)-5-[(2S,5R)-3-(benzenesulfonyl)-5-hydroxyhexan-2-yl]-13-fluoro-6,10,14-trimethyltetracyclo[7.6.0.02,6.010,14]pentadecan-13-ol |
|---|---|
| PubChem CID | 170249204 |
| Molecular Formula | C30H45FO4S |
| Molecular Weight | 520.75 g/mol |
| Exact Mass | 520.30 |
| IUPAC Name | (1S,2S,5R,6S,9S,10R,13R)-5-[(2S,5R)-3-(benzenesulfonyl)-5-hydroxyhexan-2-yl]-13-fluoro-6,10,14-trimethyltetracyclo[7.6.0.02,6.010,14]pentadecan-13-ol |
| SMILES | C[C@H](C(C[C@@H](C)O)S(=O)(=O)c1ccccc1)[C@H]1CC[C@H]2[C@@H]3CC4(C)[C@](O)(F)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C30H45FO4S/c1-19(32)17-26(36(34,35)21-9-7-6-8-10-21)20(2)23-11-12-24-22-18-29(5)28(4,15-16-30(29,31)33)25(22)13-14-27(23,24)3/h6-10,19-20,22-26,32-33H,11-18H2,1-5H3/t19-,20+,22+,23-,24+,25+,26?,27-,28-,29?,30+/m1/s1 |
| InChIKey | WFGOFGOVQHFCFP-ZLSPBGEESA-N |
| XLogP | 6.16 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.75 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |