C14H20O2 — CID 170250023
(Z,4S,11S)-tetradec-7-en-5,9-diyne-4,11-diol (PubChem CID 170250023) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is (Z,4S,11S)-tetradec-7-en-5,9-diyne-4,11-diol.
| Compound Name | (Z,4S,11S)-tetradec-7-en-5,9-diyne-4,11-diol |
|---|---|
| PubChem CID | 170250023 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | (Z,4S,11S)-tetradec-7-en-5,9-diyne-4,11-diol |
| SMILES | CCC[C@H](O)C#C/C=C\C#C[C@@H](O)CCC |
| InChI | InChI=1S/C14H20O2/c1-3-9-13(15)11-7-5-6-8-12-14(16)10-4-2/h5-6,13-16H,3-4,9-10H2,1-2H3/b6-5-/t13-,14-/m0/s1 |
| InChIKey | GYZJPSOVJGUFPY-LAWSMPECSA-N |
| XLogP | 1.87 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|