C35H44F3N5O4 — CID 170251052
3-(2-methoxyethoxy)-N-methyl-4-[3-[4-[(4-methyl-4-morpholin-4-ylcyclohexyl)amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]benzamide (PubChem CID 170251052) has the molecular formula C35H44F3N5O4 and a molecular weight of 655.76 g/mol. Its IUPAC name is 3-(2-methoxyethoxy)-N-methyl-4-[3-[4-[(4-methyl-4-morpholin-4-ylcyclohexyl)amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]benzamide.
| Compound Name | 3-(2-methoxyethoxy)-N-methyl-4-[3-[4-[(4-methyl-4-morpholin-4-ylcyclohexyl)amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]benzamide |
|---|---|
| PubChem CID | 170251052 |
| Molecular Formula | C35H44F3N5O4 |
| Molecular Weight | 655.76 g/mol |
| Exact Mass | 655.33 |
| IUPAC Name | 3-(2-methoxyethoxy)-N-methyl-4-[3-[4-[(4-methyl-4-morpholin-4-ylcyclohexyl)amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]benzamide |
| SMILES | CNC(=O)c1ccc(NCC#Cc2cc3c(NC4CCC(C)(N5CCOCC5)CC4)cccc3n2CC(F)(F)F)c(OCCOC)c1 |
| InChI | InChI=1S/C35H44F3N5O4/c1-34(42-16-18-46-19-17-42)13-11-26(12-14-34)41-29-7-4-8-31-28(29)23-27(43(31)24-35(36,37)38)6-5-15-40-30-10-9-25(33(44)39-2)22-32(30)47-21-20-45-3/h4,7-10,22-23,26,40-41H,11-21,24H2,1-3H3,(H,39,44) |
| InChIKey | LLXUNVZTEDCZEH-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.76 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|