C21H17N2O+ — CID 170251173
3,4-dimethyl-2-(1-methylpyridin-1-ium-2-yl)dibenzofuran-1-carbonitrile (PubChem CID 170251173) has the molecular formula C21H17N2O+ and a molecular weight of 313.38 g/mol. Its IUPAC name is 3,4-dimethyl-2-(1-methylpyridin-1-ium-2-yl)dibenzofuran-1-carbonitrile.
| Compound Name | 3,4-dimethyl-2-(1-methylpyridin-1-ium-2-yl)dibenzofuran-1-carbonitrile |
|---|---|
| PubChem CID | 170251173 |
| Molecular Formula | C21H17N2O+ |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 3,4-dimethyl-2-(1-methylpyridin-1-ium-2-yl)dibenzofuran-1-carbonitrile |
| SMILES | Cc1c(-c2cccc[n+]2C)c(C#N)c2c(oc3ccccc32)c1C |
| InChI | InChI=1S/C21H17N2O/c1-13-14(2)21-20(15-8-4-5-10-18(15)24-21)16(12-22)19(13)17-9-6-7-11-23(17)3/h4-11H,1-3H3/q+1 |
| InChIKey | MXGRMIHAMKXTCA-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 40.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|