C57H41N5S — CID 170251629
cyclohexa-1,5-dien-1-yl-[12-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-11H-indolo[2,3-a]carbazol-3-yl]-diphenyl-λ4-sulfane (PubChem CID 170251629) has the molecular formula C57H41N5S and a molecular weight of 828.06 g/mol. Its IUPAC name is cyclohexa-1,5-dien-1-yl-[12-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-11H-indolo[2,3-a]carbazol-3-yl]-diphenyl-λ4-sulfane.
| Compound Name | cyclohexa-1,5-dien-1-yl-[12-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-11H-indolo[2,3-a]carbazol-3-yl]-diphenyl-λ4-sulfane |
|---|---|
| PubChem CID | 170251629 |
| Molecular Formula | C57H41N5S |
| Molecular Weight | 828.06 g/mol |
| Exact Mass | 827.31 |
| IUPAC Name | cyclohexa-1,5-dien-1-yl-[12-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-11H-indolo[2,3-a]carbazol-3-yl]-diphenyl-λ4-sulfane |
| SMILES | C1=CC(S(c2ccccc2)(c2ccccc2)c2ccc3c(c2)c2ccc4c5ccccc5[nH]c4c2n3-c2cccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c2)=CCC1 |
| InChI | InChI=1S/C57H41N5S/c1-6-19-39(20-7-1)55-59-56(40-21-8-2-9-22-40)61-57(60-55)41-23-18-24-42(37-41)62-52-36-33-46(38-50(52)49-35-34-48-47-31-16-17-32-51(47)58-53(48)54(49)62)63(43-25-10-3-11-26-43,44-27-12-4-13-28-44)45-29-14-5-15-30-45/h1-4,6-14,16-38,58H,5,15H2 |
| InChIKey | WQNBXSSNQOSKIA-UHFFFAOYSA-N |
| XLogP | 15.12 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.06 |
| LogP ≤ 5 | 15.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |