C19H14N3O+ — CID 170251819
6-methyl-5-(1-methylpyridin-1-ium-2-yl)-[1]benzofuro[2,3-b]pyridine-3-carbonitrile (PubChem CID 170251819) has the molecular formula C19H14N3O+ and a molecular weight of 300.34 g/mol. Its IUPAC name is 6-methyl-5-(1-methylpyridin-1-ium-2-yl)-[1]benzofuro[2,3-b]pyridine-3-carbonitrile.
| Compound Name | 6-methyl-5-(1-methylpyridin-1-ium-2-yl)-[1]benzofuro[2,3-b]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 170251819 |
| Molecular Formula | C19H14N3O+ |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 6-methyl-5-(1-methylpyridin-1-ium-2-yl)-[1]benzofuro[2,3-b]pyridine-3-carbonitrile |
| SMILES | Cc1ccc2oc3ncc(C#N)cc3c2c1-c1cccc[n+]1C |
| InChI | InChI=1S/C19H14N3O/c1-12-6-7-16-18(17(12)15-5-3-4-8-22(15)2)14-9-13(10-20)11-21-19(14)23-16/h3-9,11H,1-2H3/q+1 |
| InChIKey | GHPRSZVCQOEMOV-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 53.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|