About [2-[4-(2,3-dihydroxypropoxy)-3-hydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] acetate
[2-[4-(2,3-dihydroxypropoxy)-3-hydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] acetate (PubChem CID 170252905) has the molecular formula C11H16O9
and a molecular weight of 292.24 g/mol. Its IUPAC name is [2-[4-(2,3-dihydroxypropoxy)-3-hydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] acetate.
Molecular Properties
| Compound Name | [2-[4-(2,3-dihydroxypropoxy)-3-hydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] acetate |
| PubChem CID | 170252905 |
| Molecular Formula | C11H16O9 |
| Molecular Weight | 292.24 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | [2-[4-(2,3-dihydroxypropoxy)-3-hydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] acetate |
| SMILES | CC(=O)OCC(O)C1OC(=O)C(OCC(O)CO)=C1O |
| InChI | InChI=1S/C11H16O9/c1-5(13)18-4-7(15)9-8(16)10(11(17)20-9)19-3-6(14)2-12/h6-7,9,12,14-16H,2-4H2,1H3 |
| InChIKey | YPBYDVIEKPXDRI-UHFFFAOYSA-N |
| XLogP | -2.02 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.24 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze [2-[4-(2,3-dihydroxypropoxy)-3-hydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[4-(2,3-dihydroxypropoxy)-3-hydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] acetate?
The IUPAC name of [2-[4-(2,3-dihydroxypropoxy)-3-hydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] acetate (CID 170252905) is [2-[4-(2,3-dihydroxypropoxy)-3-hydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] acetate.
What is the SMILES notation for [2-[4-(2,3-dihydroxypropoxy)-3-hydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] acetate?
The canonical SMILES for [2-[4-(2,3-dihydroxypropoxy)-3-hydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] acetate is CC(=O)OCC(O)C1OC(=O)C(OCC(O)CO)=C1O.
What is the InChIKey of [2-[4-(2,3-dihydroxypropoxy)-3-hydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] acetate?
The InChIKey is YPBYDVIEKPXDRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O9/c1-5(13)18-4-7(15)9-8(16)10(11(17)20-9)19-3-6(14)2-12/h6-7,9,12,14-16H,2-4H2,1H3.
What are the key properties of [2-[4-(2,3-dihydroxypropoxy)-3-hydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] acetate?
[2-[4-(2,3-dihydroxypropoxy)-3-hydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] acetate has a molecular weight of 292.24 g/mol, XLogP of -2.02, 7 rotatable bonds, 4 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[4-(2,3-dihydroxypropoxy)-3-hydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] acetate is sourced from PubChem (CID 170252905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).