C18H6F4N10 — CID 170253088
6,7,22,23-tetrafluoro-14,15-dimethyl-3,5,8,10,13,16,19,21,24,26-decazahexacyclo[16.8.0.02,11.04,9.012,17.020,25]hexacosa-1(18),2(11),3,5,7,9,12,14,16,19,21,23,25-tridecaene (PubChem CID 170253088) has the molecular formula C18H6F4N10 and a molecular weight of 438.31 g/mol. Its IUPAC name is 6,7,22,23-tetrafluoro-14,15-dimethyl-3,5,8,10,13,16,19,21,24,26-decazahexacyclo[16.8.0.02,11.04,9.012,17.020,25]hexacosa-1(18),2(11),3,5,7,9,12,14,16,19,21,23,25-tridecaene.
| Compound Name | 6,7,22,23-tetrafluoro-14,15-dimethyl-3,5,8,10,13,16,19,21,24,26-decazahexacyclo[16.8.0.02,11.04,9.012,17.020,25]hexacosa-1(18),2(11),3,5,7,9,12,14,16,19,21,23,25-tridecaene |
|---|---|
| PubChem CID | 170253088 |
| Molecular Formula | C18H6F4N10 |
| Molecular Weight | 438.31 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | 6,7,22,23-tetrafluoro-14,15-dimethyl-3,5,8,10,13,16,19,21,24,26-decazahexacyclo[16.8.0.02,11.04,9.012,17.020,25]hexacosa-1(18),2(11),3,5,7,9,12,14,16,19,21,23,25-tridecaene |
| SMILES | Cc1nc2c(nc1C)c1nc3nc(F)c(F)nc3nc1c1nc3nc(F)c(F)nc3nc21 |
| InChI | InChI=1S/C18H6F4N10/c1-3-4(2)24-6-5(23-3)7-9(27-17-15(25-7)29-11(19)13(21)31-17)10-8(6)26-16-18(28-10)32-14(22)12(20)30-16/h1-2H3 |
| InChIKey | QUQBBIMDXPETJK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 128.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|