C25H12F5N9 — CID 170253127
4,5,10,11-tetramethyl-19-(2,3,4,5,6-pentafluorophenyl)-3,6,9,12,15,17,20,22-octazapentacyclo[12.8.0.02,7.08,13.016,21]docosa-1(22),2,4,6,8,10,12,14,16,18,20-undecaene-18-carbonitrile (PubChem CID 170253127) has the molecular formula C25H12F5N9 and a molecular weight of 533.42 g/mol. Its IUPAC name is 4,5,10,11-tetramethyl-19-(2,3,4,5,6-pentafluorophenyl)-3,6,9,12,15,17,20,22-octazapentacyclo[12.8.0.02,7.08,13.016,21]docosa-1(22),2,4,6,8,10,12,14,16,18,20-undecaene-18-carbonitrile.
| Compound Name | 4,5,10,11-tetramethyl-19-(2,3,4,5,6-pentafluorophenyl)-3,6,9,12,15,17,20,22-octazapentacyclo[12.8.0.02,7.08,13.016,21]docosa-1(22),2,4,6,8,10,12,14,16,18,20-undecaene-18-carbonitrile |
|---|---|
| PubChem CID | 170253127 |
| Molecular Formula | C25H12F5N9 |
| Molecular Weight | 533.42 g/mol |
| Exact Mass | 533.11 |
| IUPAC Name | 4,5,10,11-tetramethyl-19-(2,3,4,5,6-pentafluorophenyl)-3,6,9,12,15,17,20,22-octazapentacyclo[12.8.0.02,7.08,13.016,21]docosa-1(22),2,4,6,8,10,12,14,16,18,20-undecaene-18-carbonitrile |
| SMILES | Cc1nc2c3nc(C)c(C)nc3c3nc4nc(-c5c(F)c(F)c(F)c(F)c5F)c(C#N)nc4nc3c2nc1C |
| InChI | InChI=1S/C25H12F5N9/c1-6-8(3)34-20-18(32-6)19-21(35-9(4)7(2)33-19)23-22(20)38-24-25(39-23)37-17(10(5-31)36-24)11-12(26)14(28)16(30)15(29)13(11)27/h1-4H3 |
| InChIKey | VWFBZRLVBBZWHZ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 126.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.42 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|