C10H19NO — CID 170253196
(3R,4R)-5,5-diethyl-3,4-dimethylpyrrolidin-2-one (PubChem CID 170253196) has the molecular formula C10H19NO and a molecular weight of 169.26 g/mol. Its IUPAC name is (3R,4R)-5,5-diethyl-3,4-dimethylpyrrolidin-2-one.
| Compound Name | (3R,4R)-5,5-diethyl-3,4-dimethylpyrrolidin-2-one |
|---|---|
| PubChem CID | 170253196 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.26 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | (3R,4R)-5,5-diethyl-3,4-dimethylpyrrolidin-2-one |
| SMILES | CCC1([C@@H]([C@H](C(=O)N1)C)C)CC |
| InChI | InChI=1S/C10H19NO/c1-5-10(6-2)8(4)7(3)9(12)11-10/h7-8H,5-6H2,1-4H3,(H,11,12)/t7-,8-/m1/s1 |
| InChIKey | CGOHKFJAJWUFDJ-HTQZYQBOSA-N |
| XLogP | 2.30 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | 184 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.26 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |