About [3,6-bis(dimethylamino)-6-oxohexyl] 4-(dimethylamino)pentanoate
[3,6-bis(dimethylamino)-6-oxohexyl] 4-(dimethylamino)pentanoate (PubChem CID 170253704) has the molecular formula C17H35N3O3
and a molecular weight of 329.49 g/mol. Its IUPAC name is [3,6-bis(dimethylamino)-6-oxohexyl] 4-(dimethylamino)pentanoate.
Molecular Properties
| Compound Name | [3,6-bis(dimethylamino)-6-oxohexyl] 4-(dimethylamino)pentanoate |
| PubChem CID | 170253704 |
| Molecular Formula | C17H35N3O3 |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.27 |
| IUPAC Name | [3,6-bis(dimethylamino)-6-oxohexyl] 4-(dimethylamino)pentanoate |
| SMILES | CC(CCC(=O)OCCC(CCC(=O)N(C)C)N(C)C)N(C)C |
| InChI | InChI=1S/C17H35N3O3/c1-14(18(2)3)8-11-17(22)23-13-12-15(19(4)5)9-10-16(21)20(6)7/h14-15H,8-13H2,1-7H3 |
| InChIKey | DKNVXRZTVMFTMF-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3,6-bis(dimethylamino)-6-oxohexyl] 4-(dimethylamino)pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,6-bis(dimethylamino)-6-oxohexyl] 4-(dimethylamino)pentanoate?
The IUPAC name of [3,6-bis(dimethylamino)-6-oxohexyl] 4-(dimethylamino)pentanoate (CID 170253704) is [3,6-bis(dimethylamino)-6-oxohexyl] 4-(dimethylamino)pentanoate.
What is the SMILES notation for [3,6-bis(dimethylamino)-6-oxohexyl] 4-(dimethylamino)pentanoate?
The canonical SMILES for [3,6-bis(dimethylamino)-6-oxohexyl] 4-(dimethylamino)pentanoate is CC(CCC(=O)OCCC(CCC(=O)N(C)C)N(C)C)N(C)C.
What is the InChIKey of [3,6-bis(dimethylamino)-6-oxohexyl] 4-(dimethylamino)pentanoate?
The InChIKey is DKNVXRZTVMFTMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H35N3O3/c1-14(18(2)3)8-11-17(22)23-13-12-15(19(4)5)9-10-16(21)20(6)7/h14-15H,8-13H2,1-7H3.
What are the key properties of [3,6-bis(dimethylamino)-6-oxohexyl] 4-(dimethylamino)pentanoate?
[3,6-bis(dimethylamino)-6-oxohexyl] 4-(dimethylamino)pentanoate has a molecular weight of 329.49 g/mol, XLogP of 1.45, 11 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3,6-bis(dimethylamino)-6-oxohexyl] 4-(dimethylamino)pentanoate is sourced from PubChem (CID 170253704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).