C16H23N3O6 — CID 170253850
butyl N-[2-[6-(hydroxymethyl)-7-nitro-2,3-dihydro-1,4-benzoxazin-4-yl]ethyl]carbamate (PubChem CID 170253850) has the molecular formula C16H23N3O6 and a molecular weight of 353.38 g/mol. Its IUPAC name is butyl N-[2-[6-(hydroxymethyl)-7-nitro-2,3-dihydro-1,4-benzoxazin-4-yl]ethyl]carbamate.
| Compound Name | butyl N-[2-[6-(hydroxymethyl)-7-nitro-2,3-dihydro-1,4-benzoxazin-4-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 170253850 |
| Molecular Formula | C16H23N3O6 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | butyl N-[2-[6-(hydroxymethyl)-7-nitro-2,3-dihydro-1,4-benzoxazin-4-yl]ethyl]carbamate |
| SMILES | CCCCOC(=O)NCCN1CCOc2cc([N+](=O)[O-])c(CO)cc21 |
| InChI | InChI=1S/C16H23N3O6/c1-2-3-7-25-16(21)17-4-5-18-6-8-24-15-10-13(19(22)23)12(11-20)9-14(15)18/h9-10,20H,2-8,11H2,1H3,(H,17,21) |
| InChIKey | CAAZQOXTSLIEFZ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 114.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|