About N-[(3Z)-hexa-1,3-dien-2-yl]-N'-[(Z)-pent-3-enyl]methanimidamide
N-[(3Z)-hexa-1,3-dien-2-yl]-N'-[(Z)-pent-3-enyl]methanimidamide (PubChem CID 170254205) has the molecular formula C12H20N2
and a molecular weight of 192.31 g/mol. Its IUPAC name is N-[(3Z)-hexa-1,3-dien-2-yl]-N'-[(Z)-pent-3-enyl]methanimidamide.
Molecular Properties
| Compound Name | N-[(3Z)-hexa-1,3-dien-2-yl]-N'-[(Z)-pent-3-enyl]methanimidamide |
| PubChem CID | 170254205 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | N-[(3Z)-hexa-1,3-dien-2-yl]-N'-[(Z)-pent-3-enyl]methanimidamide |
| SMILES | C=C(/C=C\CC)N/C=N/CC/C=C\C |
| InChI | InChI=1S/C12H20N2/c1-4-6-8-10-13-11-14-12(3)9-7-5-2/h4,6-7,9,11H,3,5,8,10H2,1-2H3,(H,13,14)/b6-4-,9-7- |
| InChIKey | ZYGLVDZITIIHBP-PJPBHMPJSA-N |
| XLogP | 3.05 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(3Z)-hexa-1,3-dien-2-yl]-N'-[(Z)-pent-3-enyl]methanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3Z)-hexa-1,3-dien-2-yl]-N'-[(Z)-pent-3-enyl]methanimidamide?
The IUPAC name of N-[(3Z)-hexa-1,3-dien-2-yl]-N'-[(Z)-pent-3-enyl]methanimidamide (CID 170254205) is N-[(3Z)-hexa-1,3-dien-2-yl]-N'-[(Z)-pent-3-enyl]methanimidamide.
What is the SMILES notation for N-[(3Z)-hexa-1,3-dien-2-yl]-N'-[(Z)-pent-3-enyl]methanimidamide?
The canonical SMILES for N-[(3Z)-hexa-1,3-dien-2-yl]-N'-[(Z)-pent-3-enyl]methanimidamide is C=C(/C=C\CC)N/C=N/CC/C=C\C.
What is the InChIKey of N-[(3Z)-hexa-1,3-dien-2-yl]-N'-[(Z)-pent-3-enyl]methanimidamide?
The InChIKey is ZYGLVDZITIIHBP-PJPBHMPJSA-N. The full InChI is InChI=1S/C12H20N2/c1-4-6-8-10-13-11-14-12(3)9-7-5-2/h4,6-7,9,11H,3,5,8,10H2,1-2H3,(H,13,14)/b6-4-,9-7-.
What are the key properties of N-[(3Z)-hexa-1,3-dien-2-yl]-N'-[(Z)-pent-3-enyl]methanimidamide?
N-[(3Z)-hexa-1,3-dien-2-yl]-N'-[(Z)-pent-3-enyl]methanimidamide has a molecular weight of 192.31 g/mol, XLogP of 3.05, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3Z)-hexa-1,3-dien-2-yl]-N'-[(Z)-pent-3-enyl]methanimidamide is sourced from PubChem (CID 170254205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).