C10H13FN2 — CID 170254474
4-fluoro-1-N,2-N,3,6-tetramethylcyclohexa-3,5-diene-1,2-diimine (PubChem CID 170254474) has the molecular formula C10H13FN2 and a molecular weight of 180.23 g/mol. Its IUPAC name is 4-fluoro-1-N,2-N,3,6-tetramethylcyclohexa-3,5-diene-1,2-diimine.
| Compound Name | 4-fluoro-1-N,2-N,3,6-tetramethylcyclohexa-3,5-diene-1,2-diimine |
|---|---|
| PubChem CID | 170254474 |
| Molecular Formula | C10H13FN2 |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.11 |
| IUPAC Name | 4-fluoro-1-N,2-N,3,6-tetramethylcyclohexa-3,5-diene-1,2-diimine |
| SMILES | C/N=C1\C(C)=CC(F)=C(C)\C1=N/C |
| InChI | InChI=1S/C10H13FN2/c1-6-5-8(11)7(2)10(13-4)9(6)12-3/h5H,1-4H3/b12-9+,13-10+ |
| InChIKey | RVAOICJVBNHQHM-JOWSBRCASA-N |
| XLogP | 2.33 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|