C17H25N3O3S — CID 170254747
4-amino-N-[3-(diethylamino)propyl]-3-hydroxynaphthalene-1-sulfonamide (PubChem CID 170254747) has the molecular formula C17H25N3O3S and a molecular weight of 351.47 g/mol. Its IUPAC name is 4-amino-N-[3-(diethylamino)propyl]-3-hydroxynaphthalene-1-sulfonamide.
| Compound Name | 4-amino-N-[3-(diethylamino)propyl]-3-hydroxynaphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 170254747 |
| Molecular Formula | C17H25N3O3S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 4-amino-N-[3-(diethylamino)propyl]-3-hydroxynaphthalene-1-sulfonamide |
| SMILES | CCN(CC)CCCNS(=O)(=O)c1cc(O)c(N)c2ccccc12 |
| InChI | InChI=1S/C17H25N3O3S/c1-3-20(4-2)11-7-10-19-24(22,23)16-12-15(21)17(18)14-9-6-5-8-13(14)16/h5-6,8-9,12,19,21H,3-4,7,10-11,18H2,1-2H3 |
| InChIKey | FYQSVAICNLCEGR-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|