C30H40O4 — CID 170254856
(5E,8E,11E)-15-[(3Z,5E,8E,11E)-2-oxo-14-propyl-1-oxacyclotetradeca-3,5,8,11-tetraen-3-yl]-1-oxacyclopentadeca-5,8,11-trien-2-one (PubChem CID 170254856) has the molecular formula C30H40O4 and a molecular weight of 464.65 g/mol. Its IUPAC name is (5E,8E,11E)-15-[(3Z,5E,8E,11E)-2-oxo-14-propyl-1-oxacyclotetradeca-3,5,8,11-tetraen-3-yl]-1-oxacyclopentadeca-5,8,11-trien-2-one.
| Compound Name | (5E,8E,11E)-15-[(3Z,5E,8E,11E)-2-oxo-14-propyl-1-oxacyclotetradeca-3,5,8,11-tetraen-3-yl]-1-oxacyclopentadeca-5,8,11-trien-2-one |
|---|---|
| PubChem CID | 170254856 |
| Molecular Formula | C30H40O4 |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.29 |
| IUPAC Name | (5E,8E,11E)-15-[(3Z,5E,8E,11E)-2-oxo-14-propyl-1-oxacyclotetradeca-3,5,8,11-tetraen-3-yl]-1-oxacyclopentadeca-5,8,11-trien-2-one |
| SMILES | CCCC1C/C=C/C/C=C/C/C=C/C=C(/C2CC/C=C/C/C=C/C/C=C/CCC(=O)O2)C(=O)O1 |
| InChI | InChI=1S/C30H40O4/c1-2-21-26-22-17-13-9-7-8-10-14-18-23-27(30(32)33-26)28-24-19-15-11-5-3-4-6-12-16-20-25-29(31)34-28/h3-4,7-8,11-18,23,26,28H,2,5-6,9-10,19-22,24-25H2,1H3/b4-3+,8-7+,15-11+,16-12+,17-13+,18-14+,27-23- |
| InChIKey | MLUQTRWQNHQEJA-PZXFKHAJSA-N |
| XLogP | 7.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|