About (4R)-9-(1-ethoxyethyl)-7-ethyl-7,9-diazatricyclo[3.3.1.02,4]nonane
(4R)-9-(1-ethoxyethyl)-7-ethyl-7,9-diazatricyclo[3.3.1.02,4]nonane (PubChem CID 170255500) has the molecular formula C13H24N2O
and a molecular weight of 224.35 g/mol. Its IUPAC name is (4R)-9-(1-ethoxyethyl)-7-ethyl-7,9-diazatricyclo[3.3.1.02,4]nonane.
Molecular Properties
| Compound Name | (4R)-9-(1-ethoxyethyl)-7-ethyl-7,9-diazatricyclo[3.3.1.02,4]nonane |
| PubChem CID | 170255500 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | (4R)-9-(1-ethoxyethyl)-7-ethyl-7,9-diazatricyclo[3.3.1.02,4]nonane |
| SMILES | CCOC(C)N1C2CN(CC)CC1[C@@H]1CC21 |
| InChI | InChI=1S/C13H24N2O/c1-4-14-7-12-10-6-11(10)13(8-14)15(12)9(3)16-5-2/h9-13H,4-8H2,1-3H3/t9?,10-,11?,12?,13?/m1/s1 |
| InChIKey | CFAHCMHNRXMIKC-TZESXAPASA-N |
| XLogP | 1.39 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4R)-9-(1-ethoxyethyl)-7-ethyl-7,9-diazatricyclo[3.3.1.02,4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-9-(1-ethoxyethyl)-7-ethyl-7,9-diazatricyclo[3.3.1.02,4]nonane?
The IUPAC name of (4R)-9-(1-ethoxyethyl)-7-ethyl-7,9-diazatricyclo[3.3.1.02,4]nonane (CID 170255500) is (4R)-9-(1-ethoxyethyl)-7-ethyl-7,9-diazatricyclo[3.3.1.02,4]nonane.
What is the SMILES notation for (4R)-9-(1-ethoxyethyl)-7-ethyl-7,9-diazatricyclo[3.3.1.02,4]nonane?
The canonical SMILES for (4R)-9-(1-ethoxyethyl)-7-ethyl-7,9-diazatricyclo[3.3.1.02,4]nonane is CCOC(C)N1C2CN(CC)CC1[C@@H]1CC21.
What is the InChIKey of (4R)-9-(1-ethoxyethyl)-7-ethyl-7,9-diazatricyclo[3.3.1.02,4]nonane?
The InChIKey is CFAHCMHNRXMIKC-TZESXAPASA-N. The full InChI is InChI=1S/C13H24N2O/c1-4-14-7-12-10-6-11(10)13(8-14)15(12)9(3)16-5-2/h9-13H,4-8H2,1-3H3/t9?,10-,11?,12?,13?/m1/s1.
What are the key properties of (4R)-9-(1-ethoxyethyl)-7-ethyl-7,9-diazatricyclo[3.3.1.02,4]nonane?
(4R)-9-(1-ethoxyethyl)-7-ethyl-7,9-diazatricyclo[3.3.1.02,4]nonane has a molecular weight of 224.35 g/mol, XLogP of 1.39, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-9-(1-ethoxyethyl)-7-ethyl-7,9-diazatricyclo[3.3.1.02,4]nonane is sourced from PubChem (CID 170255500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).