C6H13FN4OP2 — CID 170255796
1-[3-[2-fluoro-2,2-bis(phosphanyl)ethoxy]-1H-1,2,4-triazol-5-yl]ethanamine (PubChem CID 170255796) has the molecular formula C6H13FN4OP2 and a molecular weight of 238.14 g/mol. Its IUPAC name is 1-[3-[2-fluoro-2,2-bis(phosphanyl)ethoxy]-1H-1,2,4-triazol-5-yl]ethanamine.
| Compound Name | 1-[3-[2-fluoro-2,2-bis(phosphanyl)ethoxy]-1H-1,2,4-triazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 170255796 |
| Molecular Formula | C6H13FN4OP2 |
| Molecular Weight | 238.14 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 1-[3-[2-fluoro-2,2-bis(phosphanyl)ethoxy]-1H-1,2,4-triazol-5-yl]ethanamine |
| SMILES | CC(N)c1nc(OCC(F)(P)P)n[nH]1 |
| InChI | InChI=1S/C6H13FN4OP2/c1-3(8)4-9-5(11-10-4)12-2-6(7,13)14/h3H,2,8,13-14H2,1H3,(H,9,10,11) |
| InChIKey | QNGREMWRBQZSKE-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.14 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|