C16H22O4 — CID 170255846
benzyl (2R,3R)-3-methoxy-2-methyl-3-[(2S)-oxolan-2-yl]propanoate (PubChem CID 170255846) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is benzyl (2R,3R)-3-methoxy-2-methyl-3-[(2S)-oxolan-2-yl]propanoate.
| Compound Name | benzyl (2R,3R)-3-methoxy-2-methyl-3-[(2S)-oxolan-2-yl]propanoate |
|---|---|
| PubChem CID | 170255846 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | benzyl (2R,3R)-3-methoxy-2-methyl-3-[(2S)-oxolan-2-yl]propanoate |
| SMILES | CO[C@@H]([C@@H]1CCCO1)[C@@H](C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H22O4/c1-12(15(18-2)14-9-6-10-19-14)16(17)20-11-13-7-4-3-5-8-13/h3-5,7-8,12,14-15H,6,9-11H2,1-2H3/t12-,14+,15-/m1/s1 |
| InChIKey | ZERVEFAWUXPEED-VHDGCEQUSA-N |
| XLogP | 2.56 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |