C16H17N3O4 — CID 170256566
4-[[(2S)-1-amino-1-oxo-3-quinolin-4-ylpropan-2-yl]amino]-4-oxobutanoic acid (PubChem CID 170256566) has the molecular formula C16H17N3O4 and a molecular weight of 315.33 g/mol. Its IUPAC name is 4-[[(2S)-1-amino-1-oxo-3-quinolin-4-ylpropan-2-yl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[(2S)-1-amino-1-oxo-3-quinolin-4-ylpropan-2-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 170256566 |
| Molecular Formula | C16H17N3O4 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 4-[[(2S)-1-amino-1-oxo-3-quinolin-4-ylpropan-2-yl]amino]-4-oxobutanoic acid |
| SMILES | NC(=O)[C@H](Cc1ccnc2ccccc12)NC(=O)CCC(=O)O |
| InChI | InChI=1S/C16H17N3O4/c17-16(23)13(19-14(20)5-6-15(21)22)9-10-7-8-18-12-4-2-1-3-11(10)12/h1-4,7-8,13H,5-6,9H2,(H2,17,23)(H,19,20)(H,21,22)/t13-/m0/s1 |
| InChIKey | XBDNMCYNDFWBCL-ZDUSSCGKSA-N |
| XLogP | 0.61 |
| TPSA | 122.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |