About 3,5-bis(3,4-dimethylphenyl)-1-[(4-ethenylphenyl)methyl]-4-methylpyrazole
3,5-bis(3,4-dimethylphenyl)-1-[(4-ethenylphenyl)methyl]-4-methylpyrazole (PubChem CID 17025686) has the molecular formula C29H30N2
and a molecular weight of 406.57 g/mol. Its IUPAC name is 3,5-bis(3,4-dimethylphenyl)-1-[(4-ethenylphenyl)methyl]-4-methylpyrazole.
Molecular Properties
| Compound Name | 3,5-bis(3,4-dimethylphenyl)-1-[(4-ethenylphenyl)methyl]-4-methylpyrazole |
| PubChem CID | 17025686 |
| Molecular Formula | C29H30N2 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | 3,5-bis(3,4-dimethylphenyl)-1-[(4-ethenylphenyl)methyl]-4-methylpyrazole |
| SMILES | C=Cc1ccc(Cn2nc(-c3ccc(C)c(C)c3)c(C)c2-c2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C29H30N2/c1-7-24-10-12-25(13-11-24)18-31-29(27-15-9-20(3)22(5)17-27)23(6)28(30-31)26-14-8-19(2)21(4)16-26/h7-17H,1,18H2,2-6H3 |
| InChIKey | UIRUBGILOGEPST-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5-bis(3,4-dimethylphenyl)-1-[(4-ethenylphenyl)methyl]-4-methylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-bis(3,4-dimethylphenyl)-1-[(4-ethenylphenyl)methyl]-4-methylpyrazole?
The IUPAC name of 3,5-bis(3,4-dimethylphenyl)-1-[(4-ethenylphenyl)methyl]-4-methylpyrazole (CID 17025686) is 3,5-bis(3,4-dimethylphenyl)-1-[(4-ethenylphenyl)methyl]-4-methylpyrazole.
What is the SMILES notation for 3,5-bis(3,4-dimethylphenyl)-1-[(4-ethenylphenyl)methyl]-4-methylpyrazole?
The canonical SMILES for 3,5-bis(3,4-dimethylphenyl)-1-[(4-ethenylphenyl)methyl]-4-methylpyrazole is C=Cc1ccc(Cn2nc(-c3ccc(C)c(C)c3)c(C)c2-c2ccc(C)c(C)c2)cc1.
What is the InChIKey of 3,5-bis(3,4-dimethylphenyl)-1-[(4-ethenylphenyl)methyl]-4-methylpyrazole?
The InChIKey is UIRUBGILOGEPST-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H30N2/c1-7-24-10-12-25(13-11-24)18-31-29(27-15-9-20(3)22(5)17-27)23(6)28(30-31)26-14-8-19(2)21(4)16-26/h7-17H,1,18H2,2-6H3.
What are the key properties of 3,5-bis(3,4-dimethylphenyl)-1-[(4-ethenylphenyl)methyl]-4-methylpyrazole?
3,5-bis(3,4-dimethylphenyl)-1-[(4-ethenylphenyl)methyl]-4-methylpyrazole has a molecular weight of 406.57 g/mol, XLogP of 7.45, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-bis(3,4-dimethylphenyl)-1-[(4-ethenylphenyl)methyl]-4-methylpyrazole is sourced from PubChem (CID 17025686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).