C48H44N2 — CID 170257238
4-cyclohexa-1,3-dien-1-yl-N-(4-cyclohexa-1,5-dien-1-ylphenyl)-N-[4-[4-(1,2,3,4,6,7-hexahydrocarbazol-9-yl)phenyl]phenyl]aniline (PubChem CID 170257238) has the molecular formula C48H44N2 and a molecular weight of 648.89 g/mol. Its IUPAC name is 4-cyclohexa-1,3-dien-1-yl-N-(4-cyclohexa-1,5-dien-1-ylphenyl)-N-[4-[4-(1,2,3,4,6,7-hexahydrocarbazol-9-yl)phenyl]phenyl]aniline.
| Compound Name | 4-cyclohexa-1,3-dien-1-yl-N-(4-cyclohexa-1,5-dien-1-ylphenyl)-N-[4-[4-(1,2,3,4,6,7-hexahydrocarbazol-9-yl)phenyl]phenyl]aniline |
|---|---|
| PubChem CID | 170257238 |
| Molecular Formula | C48H44N2 |
| Molecular Weight | 648.89 g/mol |
| Exact Mass | 648.35 |
| IUPAC Name | 4-cyclohexa-1,3-dien-1-yl-N-(4-cyclohexa-1,5-dien-1-ylphenyl)-N-[4-[4-(1,2,3,4,6,7-hexahydrocarbazol-9-yl)phenyl]phenyl]aniline |
| SMILES | C1=CCCC(c2ccc(N(c3ccc(C4=CCCC=C4)cc3)c3ccc(-c4ccc(-n5c6c(c7c5=CCCC=7)CCCC6)cc4)cc3)cc2)=C1 |
| InChI | InChI=1S/C48H44N2/c1-3-11-35(12-4-1)37-19-27-41(28-20-37)49(42-29-21-38(22-30-42)36-13-5-2-6-14-36)43-31-23-39(24-32-43)40-25-33-44(34-26-40)50-47-17-9-7-15-45(47)46-16-8-10-18-48(46)50/h1,3,5,11,13-15,17,19-34H,2,4,6-10,12,16,18H2 |
| InChIKey | RABGFYSPYYRCRA-UHFFFAOYSA-N |
| XLogP | 11.31 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.89 |
| LogP ≤ 5 | 11.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |