About (4E,5E)-3-tert-butyl-4,5-di(ethylidene)-6-methylpyridazine
(4E,5E)-3-tert-butyl-4,5-di(ethylidene)-6-methylpyridazine (PubChem CID 170258495) has the molecular formula C13H20N2
and a molecular weight of 204.32 g/mol. Its IUPAC name is (4E,5E)-3-tert-butyl-4,5-di(ethylidene)-6-methylpyridazine.
Molecular Properties
| Compound Name | (4E,5E)-3-tert-butyl-4,5-di(ethylidene)-6-methylpyridazine |
| PubChem CID | 170258495 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | (4E,5E)-3-tert-butyl-4,5-di(ethylidene)-6-methylpyridazine |
| SMILES | C/C=c1/c(C)nnc(C(C)(C)C)/c1=C/C |
| InChI | InChI=1S/C13H20N2/c1-7-10-9(3)14-15-12(11(10)8-2)13(4,5)6/h7-8H,1-6H3/b10-7-,11-8+ |
| InChIKey | CIVGXQTZSIZBGW-BDLVGCLISA-N |
| XLogP | 1.68 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4E,5E)-3-tert-butyl-4,5-di(ethylidene)-6-methylpyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E,5E)-3-tert-butyl-4,5-di(ethylidene)-6-methylpyridazine?
The IUPAC name of (4E,5E)-3-tert-butyl-4,5-di(ethylidene)-6-methylpyridazine (CID 170258495) is (4E,5E)-3-tert-butyl-4,5-di(ethylidene)-6-methylpyridazine.
What is the SMILES notation for (4E,5E)-3-tert-butyl-4,5-di(ethylidene)-6-methylpyridazine?
The canonical SMILES for (4E,5E)-3-tert-butyl-4,5-di(ethylidene)-6-methylpyridazine is C/C=c1/c(C)nnc(C(C)(C)C)/c1=C/C.
What is the InChIKey of (4E,5E)-3-tert-butyl-4,5-di(ethylidene)-6-methylpyridazine?
The InChIKey is CIVGXQTZSIZBGW-BDLVGCLISA-N. The full InChI is InChI=1S/C13H20N2/c1-7-10-9(3)14-15-12(11(10)8-2)13(4,5)6/h7-8H,1-6H3/b10-7-,11-8+.
What are the key properties of (4E,5E)-3-tert-butyl-4,5-di(ethylidene)-6-methylpyridazine?
(4E,5E)-3-tert-butyl-4,5-di(ethylidene)-6-methylpyridazine has a molecular weight of 204.32 g/mol, XLogP of 1.68, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4E,5E)-3-tert-butyl-4,5-di(ethylidene)-6-methylpyridazine is sourced from PubChem (CID 170258495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).