C20H23N5O3S2 — CID 170258579
[6-[4-[5-(2-hydroxyethyl)-1,2,5-thiadiazepan-2-yl]phenyl]sulfanyl-1H-benzimidazol-2-yl]carbamic acid (PubChem CID 170258579) has the molecular formula C20H23N5O3S2 and a molecular weight of 445.57 g/mol. Its IUPAC name is [6-[4-[5-(2-hydroxyethyl)-1,2,5-thiadiazepan-2-yl]phenyl]sulfanyl-1H-benzimidazol-2-yl]carbamic acid.
| Compound Name | [6-[4-[5-(2-hydroxyethyl)-1,2,5-thiadiazepan-2-yl]phenyl]sulfanyl-1H-benzimidazol-2-yl]carbamic acid |
|---|---|
| PubChem CID | 170258579 |
| Molecular Formula | C20H23N5O3S2 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | [6-[4-[5-(2-hydroxyethyl)-1,2,5-thiadiazepan-2-yl]phenyl]sulfanyl-1H-benzimidazol-2-yl]carbamic acid |
| SMILES | O=C(O)Nc1nc2ccc(Sc3ccc(N4CCN(CCO)CCS4)cc3)cc2[nH]1 |
| InChI | InChI=1S/C20H23N5O3S2/c26-11-9-24-7-8-25(29-12-10-24)14-1-3-15(4-2-14)30-16-5-6-17-18(13-16)22-19(21-17)23-20(27)28/h1-6,13,26H,7-12H2,(H,27,28)(H2,21,22,23) |
| InChIKey | QWYPJAGLAZBUFS-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 104.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|