About 1-[propyl-[2-(1,1,1-trifluoropropan-2-ylamino)ethyl]amino]ethanethiol
1-[propyl-[2-(1,1,1-trifluoropropan-2-ylamino)ethyl]amino]ethanethiol (PubChem CID 170259011) has the molecular formula C10H21F3N2S
and a molecular weight of 258.35 g/mol. Its IUPAC name is 1-[propyl-[2-(1,1,1-trifluoropropan-2-ylamino)ethyl]amino]ethanethiol.
Molecular Properties
| Compound Name | 1-[propyl-[2-(1,1,1-trifluoropropan-2-ylamino)ethyl]amino]ethanethiol |
| PubChem CID | 170259011 |
| Molecular Formula | C10H21F3N2S |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 1-[propyl-[2-(1,1,1-trifluoropropan-2-ylamino)ethyl]amino]ethanethiol |
| SMILES | CCCN(CCNC(C)C(F)(F)F)C(C)S |
| InChI | InChI=1S/C10H21F3N2S/c1-4-6-15(9(3)16)7-5-14-8(2)10(11,12)13/h8-9,14,16H,4-7H2,1-3H3 |
| InChIKey | DLWOOQPZKRKRKO-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[propyl-[2-(1,1,1-trifluoropropan-2-ylamino)ethyl]amino]ethanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[propyl-[2-(1,1,1-trifluoropropan-2-ylamino)ethyl]amino]ethanethiol?
The IUPAC name of 1-[propyl-[2-(1,1,1-trifluoropropan-2-ylamino)ethyl]amino]ethanethiol (CID 170259011) is 1-[propyl-[2-(1,1,1-trifluoropropan-2-ylamino)ethyl]amino]ethanethiol.
What is the SMILES notation for 1-[propyl-[2-(1,1,1-trifluoropropan-2-ylamino)ethyl]amino]ethanethiol?
The canonical SMILES for 1-[propyl-[2-(1,1,1-trifluoropropan-2-ylamino)ethyl]amino]ethanethiol is CCCN(CCNC(C)C(F)(F)F)C(C)S.
What is the InChIKey of 1-[propyl-[2-(1,1,1-trifluoropropan-2-ylamino)ethyl]amino]ethanethiol?
The InChIKey is DLWOOQPZKRKRKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21F3N2S/c1-4-6-15(9(3)16)7-5-14-8(2)10(11,12)13/h8-9,14,16H,4-7H2,1-3H3.
What are the key properties of 1-[propyl-[2-(1,1,1-trifluoropropan-2-ylamino)ethyl]amino]ethanethiol?
1-[propyl-[2-(1,1,1-trifluoropropan-2-ylamino)ethyl]amino]ethanethiol has a molecular weight of 258.35 g/mol, XLogP of 2.51, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[propyl-[2-(1,1,1-trifluoropropan-2-ylamino)ethyl]amino]ethanethiol is sourced from PubChem (CID 170259011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).